| Product Name | phthalamic acid |
| CAS No. | 88-97-1 |
| Synonyms | Phthalamic acid, (2-Carboxybenzamide); 2-Carboxybenzamide; 2-carbamoylbenzoic acid |
| InChI | InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.1461 |
| Density | 1.368g/cm3 |
| Boiling point | 394.2°C at 760 mmHg |
| Flash point | 192.2°C |
| Refractive index | 1.615 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
88-97-1 phthalamic acid
service@apichina.com