| Product Name | Phenylmaleic acid |
| CAS No. | 16110-98-8 |
| Synonyms | 2-Butenedioic acid, 2-phenyl-, (2Z)-; 2-Phenyl-2-butenedioic acid, (Z)-; (2Z)-2-phenylbut-2-enedioic acid; (2E)-2-phenylbut-2-enedioic acid |
| InChI | InChI=1/C10H8O4/c11-9(12)6-8(10(13)14)7-4-2-1-3-5-7/h1-6H,(H,11,12)(H,13,14)/b8-6+ |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.1681 |
| Density | 1.377g/cm3 |
| Boiling point | 347.8°C at 760 mmHg |
| Flash point | 178.3°C |
| Refractive index | 1.612 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
16110-98-8 phenylmaleic acid
service@apichina.com