| Product Name | Phenylacrylate |
| CAS No. | 937-41-7 |
| Synonyms | Phenyl acrylate, (Acrylic acid phenyl ester); Acrylic acid phenyl ester; Phenylacrylate Phenyl acrylate; Phenyl acrylate; phenyl prop-2-enoate |
| InChI | InChI=1/C9H8O2/c1-2-9(10)11-8-6-4-3-5-7-8/h2-7H,1H2 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.1586 |
| Density | 1.068g/cm3 |
| Boiling point | 232.2°C at 760 mmHg |
| Flash point | 88.3°C |
| Refractive index | 1.517 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
937-41-7 phenylacrylate
service@apichina.com