| Product Name | Phenyl nicotinate |
| CAS No. | 3468-53-9 |
| Synonyms | Phenyl nicotinate, (Nicotinic acid phenyl ester; Nicotinic acid phenyl ester~Phenyl pyridine-3-carboxylate; phenyl pyridine-3-carboxylate |
| InChI | InChI=1/C12H9NO2/c14-12(10-5-4-8-13-9-10)15-11-6-2-1-3-7-11/h1-9H |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.2054 |
| Density | 1.199g/cm3 |
| Melting point | 70-72℃ |
| Boiling point | 338.9°C at 760 mmHg |
| Flash point | 158.8°C |
| Refractive index | 1.589 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; R43:May cause sensitization by skin contact.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
3468-53-9 phenyl nicotinate
service@apichina.com