| Product Name | Phenyl Methacrylate |
| CAS No. | 2177-70-0 |
| Synonyms | Phenylmethacrylate, (Methacrylic acid phenyl ester); Methacrylic acid phenyl ester; phenyl 2-methylprop-2-enoate |
| InChI | InChI=1/C10H10O2/c1-8(2)10(11)12-9-6-4-3-5-7-9/h3-7H,1H2,2H3 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.1852 |
| Density | 1.046g/cm3 |
| Boiling point | 249.3°C at 760 mmHg |
| Flash point | 97.1°C |
| Refractive index | 1.511 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; |
2177-70-0 phenyl methacrylate
service@apichina.com