| Product Name | Phenyl laurate |
| CAS No. | 4228-00-6 |
| Synonyms | Dodecanoic acid phenyl ester~Phenyl dodecanoate; phenyl dodecanoate |
| InChI | InChI=1/C18H28O2/c1-2-3-4-5-6-7-8-9-13-16-18(19)20-17-14-11-10-12-15-17/h10-12,14-15H,2-9,13,16H2,1H3 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.4137 |
| Density | 0.946g/cm3 |
| Boiling point | 366.5°C at 760 mmHg |
| Flash point | 123.9°C |
| Refractive index | 1.486 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
4228-00-6 phenyl laurate
service@apichina.com
- Next:4228-10-8 5-acetylindane,97%
- Previous:4227-99-0 a-naphthyl laurate