| Product Name | Phenyl carbamate |
| CAS No. | 622-46-8 |
| Synonyms | AI3-50866; CCRIS 5071; NSC 66509; Carbamic acid, phenyl ester |
| InChI | InChI=1/C7H7NO2/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.136 |
| Density | 1.2g/cm3 |
| Melting point | 145-152℃ |
| Boiling point | 278.9°C at 760 mmHg |
| Flash point | 159.3°C |
| Refractive index | 1.551 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
622-46-8 phenyl carbamate
service@apichina.com
- Next:622-47-9 p-tolylacetic acid
- Previous:622-45-7 cyclohexyl acetate