| Product Name | phenyl(4-pyridyl)methanol |
| CAS No. | 33974-27-5 |
| Synonyms | alpha-Phenylpyridine-4-methanol; phenyl(pyridin-4-yl)methanol |
| InChI | InChI=1/C12H11NO/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h1-9,12,14H |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.2218 |
| Density | 1.155g/cm3 |
| Melting point | 120℃ |
| Boiling point | 353.5°C at 760 mmHg |
| Flash point | 167.6°C |
| Refractive index | 1.604 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
33974-27-5 phenyl(4-pyridyl)methanol
service@apichina.com