Product Name | Phenyl 4-aminosalicylate |
CAS No. | 133-11-9 |
Synonyms | 4-Amino-2-hydroxybenzoic acid phenyl ester; Phenyl PAS; fenamisal; Phenyl Aminosalicylate; ; phenyl 4-amino-2-hydroxybenzoate |
InChI | InChI=1/C13H11NO3/c14-9-6-7-11(12(15)8-9)13(16)17-10-4-2-1-3-5-10/h1-8,15H,14H2 |
Molecular Formula | C13H11NO3 |
Molecular Weight | 229.2313 |
Density | 1.32g/cm3 |
Melting point | 147-152℃ |
Boiling point | 406.4°C at 760 mmHg |
Flash point | 199.6°C |
Refractive index | 1.659 |
Hazard Symbols | |
Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
Safety | S24/25:Avoid contact with skin and eyes.; |
133-11-9 phenyl 4-aminosalicylate
service@apichina.com