| Product Name | Phenyl 4-aminosalicylate |
| CAS No. | 133-11-9 |
| Synonyms | 4-Amino-2-hydroxybenzoic acid phenyl ester; Phenyl PAS; fenamisal; Phenyl Aminosalicylate; ; phenyl 4-amino-2-hydroxybenzoate |
| InChI | InChI=1/C13H11NO3/c14-9-6-7-11(12(15)8-9)13(16)17-10-4-2-1-3-5-10/h1-8,15H,14H2 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.2313 |
| Density | 1.32g/cm3 |
| Melting point | 147-152℃ |
| Boiling point | 406.4°C at 760 mmHg |
| Flash point | 199.6°C |
| Refractive index | 1.659 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
133-11-9 phenyl 4-aminosalicylate
service@apichina.com