| Product Name | Phenacyl 4-bromocrotonate |
| CAS No. | 154561-38-3 |
| Synonyms | 4-Bromocrotonic acid phenacyl ester; 2-oxo-2-phenylethyl (2E)-4-bromobut-2-enoate |
| InChI | InChI=1/C12H11BrO3/c13-8-4-7-12(15)16-9-11(14)10-5-2-1-3-6-10/h1-7H,8-9H2/b7-4+ |
| Molecular Formula | C12H11BrO3 |
| Molecular Weight | 283.1179 |
| Density | 1.435g/cm3 |
| Boiling point | 382°C at 760 mmHg |
| Flash point | 184.8°C |
| Refractive index | 1.566 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
154561-38-3 phenacyl 4-bromocrotonate
service@apichina.com