| Product Name | Pentamethylphenylacetonitrile |
| CAS No. | 34688-70-5 |
| Synonyms | 2,3,4,5,6-Pentamethylbenzyl cyanide |
| InChI | InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.2808 |
| Density | 0.95g/cm3 |
| Melting point | 105-107℃ |
| Boiling point | 325.9°C at 760 mmHg |
| Flash point | 160.2°C |
| Refractive index | 1.519 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
34688-70-5 pentamethylphenylacetonitrile
service@apichina.com