| Product Name | Pentamethylbenzonitrile |
| CAS No. | 5144-10-5 |
| Synonyms | Penthamethylbenzonitrile |
| InChI | InChI=1/C12H15N/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h1-5H3 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.2542 |
| Density | 0.96g/cm3 |
| Melting point | 158-160℃ |
| Boiling point | 313.2°C at 760 mmHg |
| Flash point | 143.8°C |
| Refractive index | 1.515 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
5144-10-5 pentamethylbenzonitrile
service@apichina.com