| Product Name | pentafluorothiophenol |
| CAS No. | 771-62-0 |
| Synonyms | Pentafluorobenzenethiol |
| InChI | InChI=1/C6HF5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| Molecular Formula | C6HF5S |
| Molecular Weight | 200.12 |
| Density | 1.5 |
| Melting point | -24℃ |
| Boiling point | 143℃ |
| Flash point | 51℃ |
| Refractive index | 1.463-1.465 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R10:Flammable.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
771-62-0 pentafluorothiophenol
service@apichina.com