| Product Name | pentafluorophenylisothiocyanate |
| CAS No. | 35923-79-6 |
| Synonyms | Pentafluorophenyl isothiocyanate; Pentafluoroisothiocyanatobenzene; 1,2,3,4,5-pentafluoro-6-isothiocyanatobenzene |
| InChI | InChI=1/C7F5NS/c8-2-3(9)5(11)7(13-1-14)6(12)4(2)10 |
| Molecular Formula | C7F5NS |
| Molecular Weight | 225.1386 |
| Density | 1.55g/cm3 |
| Boiling point | 224.3°C at 760 mmHg |
| Flash point | 89.4°C |
| Refractive index | 1.492 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
35923-79-6 pentafluorophenylisothiocyanate
service@apichina.com