| Product Name | (pentafluorophenyl)dimethylsilane |
| CAS No. | 13888-77-2 |
| Synonyms | Dimethyl(pentafluorophenyl)silane |
| InChI | InChI=1/C8H7F5Si/c1-14(2)8-6(12)4(10)3(9)5(11)7(8)13/h14H,1-2H3 |
| Molecular Formula | C8H7F5Si |
| Molecular Weight | 226.2187 |
| Boiling point | 163.8°C at 760 mmHg |
| Flash point | 40.6°C |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
13888-77-2 (pentafluorophenyl)dimethylsilane
service@apichina.com