| Product Name | Pentafluorocinnamic acid |
| CAS No. | 719-60-8 |
| Synonyms | 2,3,4,5,6-Pentafluorocinnamic acid; (2E)-3-(pentafluorophenyl)prop-2-enoate; (2E)-3-(pentafluorophenyl)prop-2-enoic acid; 3-(pentafluorophenyl)prop-2-enoate |
| InChI | InChI=1/C9H3F5O2/c10-5-3(1-2-4(15)16)6(11)8(13)9(14)7(5)12/h1-2H,(H,15,16)/p-1 |
| Molecular Formula | C9H2F5O2 |
| Molecular Weight | 237.1035 |
| Melting point | 152-156℃ |
| Boiling point | 251.5°C at 760 mmHg |
| Flash point | 105.9°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
719-60-8 pentafluorocinnamic acid
service@apichina.com