| Product Name | pentafluorobenzyl propionate |
| CAS No. | 21634-97-9 |
| Synonyms | 2,3,4,5,6-Pentafluorobenzyl propionate; pentafluorobenzyl propanoate |
| InChI | InChI=1/C10H7F5O2/c1-2-5(16)17-3-4-6(11)8(13)10(15)9(14)7(4)12/h2-3H2,1H3 |
| Molecular Formula | C10H7F5O2 |
| Molecular Weight | 254.1534 |
| Density | 1.413g/cm3 |
| Boiling point | 210.4°C at 760 mmHg |
| Flash point | 83.2°C |
| Refractive index | 1.433 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
21634-97-9 pentafluorobenzyl propionate
service@apichina.com