| Product Name | Pentafluorobenzyl n-octanoate |
| CAS No. | 21635-03-0 |
| Synonyms | 2,3,4,5,6-Pentafluorobenzyl octanoate; pentafluorobenzyl octanoate |
| InChI | InChI=1/C15H17F5O2/c1-2-3-4-5-6-7-10(21)22-8-9-11(16)13(18)15(20)14(19)12(9)17/h2-8H2,1H3 |
| Molecular Formula | C15H17F5O2 |
| Molecular Weight | 324.2863 |
| Density | 1.236g/cm3 |
| Boiling point | 304°C at 760 mmHg |
| Flash point | 130.8°C |
| Refractive index | 1.446 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
21635-03-0 pentafluorobenzyl n-octanoate
service@apichina.com