| Product Name | Penta-Chloro Thiophenol |
| CAS No. | 133-49-3 |
| Synonyms | Pentachlorobenzenethiol; Pentachlorothiophenol; 2,3,4,5,6-Pentachlorobenzenethiol; Benzenethiol,pentachloro- (6CI,7CI,8CI,9CI); Benzenethiol,2,3,4,5,6-pentachloro- |
| InChI | InChI=1/C6HCl5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| Molecular Formula | C6HCl5S |
| Molecular Weight | 282.4021 |
| Density | 1.745g/cm3 |
| Melting point | 223-227℃ |
| Boiling point | 351.3°C at 760 mmHg |
| Flash point | 144.6°C |
| Refractive index | 1.648 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
133-49-3 penta-chloro thiophenol
service@apichina.com