| Product Name | Para Red |
| CAS No. | 6410-10-2 |
| Synonyms | C.I. 12070; C.I. Pigment Red 1; C.I. Pigment Red 1 (8CI); 2-Naphthalenol, 1-(2-(4-nitrophenyl)diazenyl)-; 1-(4-Nitrophenylazo)-2-naphthol; 1-[(4-nitrophenyl)hydrazono]naphthalen-2(1H)-one; (1Z)-1-[(4-nitrophenyl)hydrazono]naphthalen-2(1H)-one; (1E)-1-[(4-nitrophenyl)hydrazono]naphthalen-2(1H)-one |
| InChI | InChI=1/C16H11N3O3/c20-15-10-5-11-3-1-2-4-14(11)16(15)18-17-12-6-8-13(9-7-12)19(21)22/h1-10,17H/b18-16+ |
| Molecular Formula | C16H11N3O3 |
| Molecular Weight | 293.2768 |
| Density | 1.35g/cm3 |
| Melting point | 248-252℃ |
| Boiling point | 489.5°C at 760 mmHg |
| Flash point | 249.8°C |
| Refractive index | 1.673 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
6410-10-2 para red
service@apichina.com