| Product Name | p-Xylene |
| CAS No. | 106-42-3 |
| Synonyms | 1,4-Dimethylbenzene; para-xylene; Dibencoside; 1,4-xylene |
| InChI | InChI:1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.1674 |
| Melting point | 13-13℃ |
| Boiling point | 139.61°C at 760 mmHg |
| Flash point | 24.627°C |
| Hazard Symbols | |
| Risk Codes | R10:Flammable.; R20/21:Harmful by inhalation and in contact with skin.; R38:Irritating to skin.; |
| Safety | S25:Avoid contact with eyes.; |
106-42-3 p-xylene
service@apichina.com
- Next:106-43-4 4-chlorotoluene
- Previous:106-41-2 p-bromophenol