| Product Name | p-Tolyl disulfide |
| CAS No. | 103-19-5 |
| InChI | InChI=1/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| Molecular Formula | C14H14S2 |
| Molecular Weight | 246.391 |
| Density | 1.17g/cm3 |
| Melting point | 43-46℃ |
| Boiling point | 349.5°C at 760 mmHg |
| Flash point | 192.6°C |
| Refractive index | 1.649 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
103-19-5 p-tolyl disulfide
service@apichina.com