| Product Name | p-Phenylenediacrylic acid |
| CAS No. | 16323-43-6 |
| Synonyms | 3,3'-benzene-1,4-diylbisprop-2-enoic acid; (2'E)-3,3'-benzene-1,4-diylbisprop-2-enoic acid; (2E,2'E)-3,3'-benzene-1,4-diylbisprop-2-enoic acid; 3,3'-benzene-1,3-diylbisprop-2-enoic acid; (2E,2'E)-3,3'-benzene-1,4-diylbisprop-2-enoate; 2,2'-benzene-1,4-diylbisprop-2-enoic acid |
| InChI | InChI=1/C12H10O4/c1-7(11(13)14)9-3-5-10(6-4-9)8(2)12(15)16/h3-6H,1-2H2,(H,13,14)(H,15,16) |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.2054 |
| Density | 1.281g/cm3 |
| Melting point | 300℃ |
| Boiling point | 429.671°C at 760 mmHg |
| Flash point | 227.799°C |
| Refractive index | 1.594 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
16323-43-6 p-phenylenediacrylic acid
service@apichina.com