| Product Name | p-(Methylthio)benzyl chloride |
| CAS No. | 874-87-3 |
| Synonyms | 4-(Methylthio)benzyl chloride; 4-(Chloromethyl)thioanisole; 1-(chloromethyl)-4-(methylsulfanyl)benzene |
| InChI | InChI=1/C8H9ClS/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3 |
| Molecular Formula | C8H9ClS |
| Molecular Weight | 172.6751 |
| Density | 1.16g/cm3 |
| Boiling point | 262.3°C at 760 mmHg |
| Flash point | 110.5°C |
| Refractive index | 1.574 |
| Risk Codes | R34:Causes burns.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
874-87-3 p-(methylthio)benzyl chloride
service@apichina.com