| Product Name | p-Heptyloxyaniline |
| CAS No. | 39905-44-7 |
| Synonyms | 4-n-Heptyloxyaniline; 4-(heptyloxy)aniline |
| InChI | InChI=1/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.3119 |
| Density | 0.965g/cm3 |
| Boiling point | 325.9°C at 760 mmHg |
| Flash point | 145°C |
| Refractive index | 1.516 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
39905-44-7 p-heptyloxyaniline
service@apichina.com