| Product Name | p-butylphenol |
| CAS No. | 1638-22-8 |
| Synonyms | 4-n-Butylphenol; 4-butylphenol |
| InChI | InChI=1/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.2176 |
| Density | 0.977g/cm3 |
| Boiling point | 246.2°C at 760 mmHg |
| Flash point | 121.5°C |
| Refractive index | 1.522 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1638-22-8 p-butylphenol
service@apichina.com