| Product Name | p-Bromovalerophenone |
| CAS No. | 7295-44-5 |
| Synonyms | 4'-bromovalerophenone; 1-(4-Bromophenyl)pentan-1-one; 1-pentanone, 1-(4-bromophenyl)-; p-Bromophenyl butyl ketone |
| InChI | InChI=1/C11H13BrO/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8H,2-4H2,1H3 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.1243 |
| Density | 1.291g/cm3 |
| Melting point | 34-36℃ |
| Boiling point | 291.3°C at 760 mmHg |
| Flash point | 59.7°C |
| Refractive index | 1.532 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
7295-44-5 p-bromovalerophenone
service@apichina.com