| Product Name | oxalyl fluoride |
| CAS No. | 359-40-0 |
| Synonyms | Ethanedioyl difluoride; 4-02-00-01853 (Beilstein Handbook Reference); BRN 1743349; Difluorid kyseliny stavelove; Difluorid kyseliny stavelove [Czech]; Oxalyl difluoride; Oxalyl fluoride; TL 108 |
| InChI | InChI=1/C2F2O2/c3-1(5)2(4)6 |
| Molecular Formula | C2F2O2 |
| Molecular Weight | 94.017 |
| Density | 1.409g/cm3 |
| Boiling point | 85.6°C at 760 mmHg |
| Flash point | 21.9°C |
| Refractive index | 1.28 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; R37:Irritating to respiratory system.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
359-40-0 oxalyl fluoride
service@apichina.com