| Product Name | Oxalyl bromide |
| CAS No. | 15219-34-8 |
| Synonyms | Ethanedioyl dibromide; Ethanedioyl bromide; NSC 96957; Oxalyl bromide |
| InChI | InChI=1/C2Br2O2/c3-1(5)2(4)6 |
| Molecular Formula | C2Br2O2 |
| Molecular Weight | 215.8282 |
| Density | 2.627g/cm3 |
| Melting point | -19℃ |
| Boiling point | 118.3°C at 760 mmHg |
| Flash point | 109.8°C |
| Refractive index | 1.567 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
15219-34-8 oxalyl bromide
service@apichina.com