| Product Name | oleic acid, ester with hydroxypropanediyl diacetate |
| CAS No. | 28060-90-4 |
| Synonyms | 9-Octadecenoic acid (9Z)-, ester with 1,2,3-propanetriol diacetate; 1,2,3-Propanetriyl diacetate 9-octadecenoate, (Z)-; 9-Octadecenoic acid (Z)-, ester with 1,2,3-propanetriol diacetate; Acetin, oleodi-; Glycerol diacetate oleate; Glyceryl diacetate monooleate; Glyceryl monooleate, diacetylated; Olein, diaceto-; Oleodiacetin; Oleic acid, ester with hydroxypropanediyl diacetate; Diacetoolein; 2,3-diacetoxypropyl octadec-9-enoate |
| InChI | InChI=1/C25H44O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)30-21-24(31-23(3)27)20-29-22(2)26/h11-12,24H,4-10,13-21H2,1-3H3 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.6133 |
| Density | 0.988g/cm3 |
| Boiling point | 490°C at 760 mmHg |
| Flash point | 203.9°C |
| Refractive index | 1.465 |
28060-90-4 oleic acid, ester with hydroxypropanediyl diacetate
service@apichina.com