| Product Name | oleic acid, compound with diethylamine (1:1) |
| CAS No. | 17200-00-9 |
| Synonyms | 9-Octadecenoic acid (9Z)-, compd. with N-ethylethanamine (1:1); 9-Octadecenoic acid (Z), compd. with N-ethylethanamine; Oleic acid, compound with diethylamine (1:1); (9Z)-octadec-9-enoic acid - N-ethylethanamine (1:1) |
| InChI | InChI=1/C18H34O2.C4H11N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-4-2/h9-10H,2-8,11-17H2,1H3,(H,19,20);5H,3-4H2,1-2H3/b10-9-; |
| Molecular Formula | C22H45NO2 |
| Molecular Weight | 355.5982 |
| Boiling point | 360°C at 760 mmHg |
| Flash point | 270.1°C |
17200-00-9 oleic acid, compound with diethylamine (1:1)
service@apichina.com