| Product Name | oleic acid, compound with dicyclohexylamine (1:1) |
| CAS No. | 22256-71-9 |
| Synonyms | Oleic acid, compound with dicyclohexylamine (1:1); Caswell No. 331; Dicyclohexylamine oleate; EPA Pesticide Chemical Code 031701; Oleic acid dicyclohexylamine salt; 9-Octadecenoic acid (9Z)-, compd. with N-cyclohexylcyclohexanamine (1:1); N-cyclohexylcyclohexanamine; (Z)-octadec-9-enoate |
| InChI | InChI=1/C18H34O2.C12H23N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h9-10H,2-8,11-17H2,1H3,(H,19,20);11-13H,1-10H2/p-1/b10-9-; |
| Molecular Formula | C30H56NO2 |
| Molecular Weight | 462.7717 |
| Boiling point | 360°C at 760 mmHg |
| Flash point | 270.1°C |
22256-71-9 oleic acid, compound with dicyclohexylamine (1:1)
service@apichina.com