| Product Name | oleic acid, compound with 3-methoxypropylamine (1:1) |
| CAS No. | 68214-77-7 |
| Synonyms | 9-Octadecenoic acid (9Z)-, compd. with 3-methoxy-1-propanamine (1:1); 3-Methoxypropylamine oleate; 3-Methoxypropylamine, oleic acid salt; Oleic acid, compound with 3-methoxypropylamine (1:1); (9Z)-octadec-9-enoic acid - 3-methoxypropan-1-amine (1:1) |
| InChI | InChI=1/C18H34O2.C4H11NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-6-4-2-3-5/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-5H2,1H3/b10-9-; |
| Molecular Formula | C22H45NO3 |
| Molecular Weight | 371.5976 |
| Boiling point | 360°C at 760 mmHg |
| Flash point | 270.1°C |
68214-77-7 oleic acid, compound with 3-methoxypropylamine (1:1)
service@apichina.com