| Product Name | oleic acid, compound with 2-(diethylamino)ethanol (1:1) |
| CAS No. | 67923-77-7 |
| Synonyms | 9-Octadecenoic acid (9Z)-, compd. with 2-(diethylamino)ethanol (1:1); Diethyl aminoethanol oleate; Oleic acid, diethylaminoethanol salt; Oleic acid, diethylaminoethanol soap; Oleic acid, diethylethanolamine soap; Oleic acid, compound with 2-(diethylamino)ethanol (1:1); (9Z)-octadec-9-enoic acid - 2-(diethylamino)ethanol (1:1) |
| InChI | InChI=1/C18H34O2.C6H15NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-7(4-2)5-6-8/h9-10H,2-8,11-17H2,1H3,(H,19,20);8H,3-6H2,1-2H3/b10-9-; |
| Molecular Formula | C24H49NO3 |
| Molecular Weight | 399.6508 |
| Boiling point | 360°C at 760 mmHg |
| Flash point | 270.1°C |
67923-77-7 oleic acid, compound with 2-(diethylamino)ethanol (1:1)
service@apichina.com