| Product Name | oleic acid, compound with 1,3,5-triazine-1,3,5(2H,4H,6H)-triethanol |
| CAS No. | 68227-25-8 |
| Synonyms | 9-Octadecenoic acid (9Z)-, compd. with 1,3,5-triazine-1,3,5(2H,4H,6H)-triethanol (1:?); Oleic acid, hexahydro-1,3,5-tris(2-hydroxyethyl)-s-triazine salt; 9-Octadecenoic acid (9Z)-, compd. with 1,3,5-triazine-1,3,5(2H,4H,6H)-triethanol; Oleic acid, compound with 1,3,5-triazine-1,3,5(2H,4H,6H)-triethanol; (9Z)-octadec-9-enoic acid - 2,2',2''-(1,3,5-triazinane-1,3,5-triyl)triethanol (1:1) |
| InChI | InChI=1/C18H34O2.C9H21N3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;13-4-1-10-7-11(2-5-14)9-12(8-10)3-6-15/h9-10H,2-8,11-17H2,1H3,(H,19,20);13-15H,1-9H2/b10-9-; |
| Molecular Formula | C27H55N3O5 |
| Molecular Weight | 501.7427 |
| Boiling point | 360°C at 760 mmHg |
| Flash point | 270.1°C |
68227-25-8 oleic acid, compound with 1,3,5-triazine-1,3,5(2h,4h,6h)-triethanol
service@apichina.com