| Product Name | Oil Blue N |
| CAS No. | 2646-15-3 |
| Synonyms | C.I. 61555; C.I. Solvent Blue 14; 9,10-Anthracenedione, 1,4-bis(pentylamino)-; 1,4-Bis(pentylamino)anthraquinone; Oil Blue M; Solvent Blue 14; 1,4-bis(pentylamino)anthracene-9,10-dione |
| InChI | InChI=1/C24H30N2O2/c1-3-5-9-15-25-19-13-14-20(26-16-10-6-4-2)22-21(19)23(27)17-11-7-8-12-18(17)24(22)28/h7-8,11-14,25-26H,3-6,9-10,15-16H2,1-2H3 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.5072 |
| Density | 1.146g/cm3 |
| Melting point | 210℃ |
| Boiling point | 586°C at 760 mmHg |
| Flash point | 179.9°C |
| Refractive index | 1.613 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
2646-15-3 oil blue n
service@apichina.com