| Product Name | Octanolactone |
| CAS No. | 698-76-0 |
| Synonyms | 5-Hydroxyoctanoic acid lactone; delta-Octalactone; 1,5-Octanolide; 6-propyltetrahydro-2H-pyran-2-one; Delta Octalactone |
| InChI | InChI=1/C8H14O2/c1-2-4-7-5-3-6-8(9)10-7/h7H,2-6H2,1H3 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.1956 |
| Density | 0.96g/cm3 |
| Boiling point | 239.8°C at 760 mmHg |
| Flash point | 92.2°C |
| Refractive index | 1.436 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
698-76-0 octanolactone
service@apichina.com