| Product Name | Octanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol |
| CAS No. | 70750-12-8 |
| Synonyms | Octanoic acid, reaction products with 2-((2-aminoethyl)amino)ethanol; Caprylic acid, aminoethylethanolamine reaction product; Reaction products of octanoic acid with aminoethylethanolamine; octanoic acid - 2-[(2-aminoethyl)amino]ethanol (1:1) |
| InChI | InChI=1/C8H16O2.C4H12N2O/c1-2-3-4-5-6-7-8(9)10;5-1-2-6-3-4-7/h2-7H2,1H3,(H,9,10);6-7H,1-5H2 |
| Molecular Formula | C12H28N2O3 |
| Molecular Weight | 248.3623 |
| Boiling point | 239.3°C at 760 mmHg |
| Flash point | 107.4°C |
70750-12-8 octanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol
service@apichina.com