| Product Name | Octanoic acid, mixed diesters with hexanoic acid and triethylene glycol |
| CAS No. | 68130-48-3 |
| Synonyms | Caproic acid, caprylic acid diesters with triethylene glycol; Octanoic acid mixed diesters with hexanoic acid and triethylene glycol |
| InChI | InChI=1/C8H16O2.C6H14O4.C6H12O2/c1-2-3-4-5-6-7-8(9)10;7-1-3-9-5-6-10-4-2-8;1-2-3-4-5-6(7)8/h2-7H2,1H3,(H,9,10);7-8H,1-6H2;2-5H2,1H3,(H,7,8) |
| Molecular Formula | C20H42O8 |
| Molecular Weight | 410.5427 |
| Boiling point | 239.3°C at 760 mmHg |
| Flash point | 107.4°C |
68130-48-3 octanoic acid, mixed diesters with hexanoic acid and triethylene glycol
service@apichina.com