| Product Name | octanoic acid, compound with 2-(diethylamino)ethanol (1:1) |
| CAS No. | 68052-35-7 |
| Synonyms | Octanoic acid, compd. with 2-(diethylamino)ethanol (1:1); Diethylethanolamine caprylate; Octanoic acid diethylethanolamine salt; Octanoic acid, compound with 2-(diethylamino)ethanol (1:1); octanoic acid - 2-(diethylamino)ethanol (1:1) |
| InChI | InChI=1/C8H16O2.C6H15NO/c1-2-3-4-5-6-7-8(9)10;1-3-7(4-2)5-6-8/h2-7H2,1H3,(H,9,10);8H,3-6H2,1-2H3 |
| Molecular Formula | C14H31NO3 |
| Molecular Weight | 261.4008 |
| Boiling point | 239.3°C at 760 mmHg |
| Flash point | 107.4°C |
68052-35-7 octanoic acid, compound with 2-(diethylamino)ethanol (1:1)
service@apichina.com