| Product Name | Octadecanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol and urea |
| CAS No. | 68412-14-6 |
| Synonyms | Octadecanoic acid, reaction products with 2-((2-aminoethyl)amino)ethanol and urea; Reaction products of stearic acid with aminoethylethanolamine and urea; Urea, stearic acid, 2-((2-aminoethyl)amino)ethanol condensation product; 2-(2-aminoethylamino)ethanol: stearic acid: urea |
| InChI | InChI=1/C18H36O2.C4H12N2O.CH4N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-2-6-3-4-7;2-1(3)4/h2-17H2,1H3,(H,19,20);6-7H,1-5H2;(H4,2,3,4) |
| Molecular Formula | C23H52N4O4 |
| Molecular Weight | 448.6834 |
| Boiling point | 359.4°C at 760 mmHg |
| Flash point | 162.4°C |
68412-14-6 octadecanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol and urea
service@apichina.com