| Product Name | o-Xylene-d10 |
| CAS No. | 56004-61-6 |
| Synonyms | (2H10)-o-Xylene; 1,2-bis[(~2~H_3_)methyl](~2~H_4_)benzene |
| InChI | InChI=1/C8H10/c1-7-5-3-4-6-8(7)2/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D |
| Molecular Formula | C8D10 |
| Molecular Weight | 116.2266 |
| Density | 0.952g/cm3 |
| Melting point | -25℃ |
| Boiling point | 145.9°C at 760 mmHg |
| Flash point | 28.9°C |
| Refractive index | 1.5 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R10:Flammable.; R20/21:Harmful by inhalation and in contact with skin.; R38:Irritating to skin.; |
| Safety | S25:Avoid contact with eyes.; |
56004-61-6 o-xylene-d10
service@apichina.com