| Product Name | o-Tolyl benzoate |
| CAS No. | 617-02-7 |
| Synonyms | o-Tolyl benzoate (Benzoic acid o-tolyl ester); Benzoic acid o-tolyl ester; 2-methylphenyl benzoate |
| InChI | InChI=1/C14H12O2/c1-11-7-5-6-10-13(11)16-14(15)12-8-3-2-4-9-12/h2-10H,1H3 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.2439 |
| Density | 1.122g/cm3 |
| Boiling point | 368.9°C at 760 mmHg |
| Flash point | 154.5°C |
| Refractive index | 1.577 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
617-02-7 o-tolyl benzoate
service@apichina.com