| Product Name | O,O-bis(sec-butyl) hydrogen dithiophosphate, compound with dicyclohexylamine (1:1) |
| CAS No. | 70682-65-4 |
| Synonyms | Phosphorodithioic acid, O,O-bis(1-methylpropyl) ester, compd. with N-cyclohexylcyclohexanamine (1:1); O,O-Bis(1-methylpropyl) dithiophosphate, dicyclohexylamine salt; O,O-Bis(sec-butyl) hydrogen dithiophosphate, compound with dicyclohexylamine (1:1); O,O-dibutan-2-yl hydrogen phosphorodithioate - N-cyclohexylcyclohexanamine (1:1) |
| InChI | InChI=1/C12H23N.C8H19O2PS2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-7(3)9-11(12,13)10-8(4)6-2/h11-13H,1-10H2;7-8H,5-6H2,1-4H3,(H,12,13) |
| Molecular Formula | C20H42NO2PS2 |
| Molecular Weight | 423.6567 |
| Boiling point | 256.1°C at 760 mmHg |
| Flash point | 96.1°C |
70682-65-4 o,o-bis(sec-butyl) hydrogen dithiophosphate, compound with dicyclohexylamine (1:1)
service@apichina.com