| Product Name | o-Nitrocinnamaldehyde |
| CAS No. | 1466-88-2 |
| Synonyms | 2-Nitrocinnamaldehyde; 3-(2-nitrophenyl)prop-2-enal; (2E)-3-(2-nitrophenyl)prop-2-enal |
| InChI | InChI=1/C9H7NO3/c11-7-3-5-8-4-1-2-6-9(8)10(12)13/h1-7H/b5-3+ |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.1568 |
| Density | 1.269g/cm3 |
| Melting point | 125-126℃ |
| Boiling point | 348.1°C at 760 mmHg |
| Flash point | 178.1°C |
| Refractive index | 1.617 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1466-88-2 o-nitrocinnamaldehyde
service@apichina.com