| Product Name | o-Cresotic Hydrazide |
| CAS No. | 30991-42-5 |
| Synonyms | 2-Hydroxy-3-methylbenzhydrazide; 3-Methylsalicylhydrazide; 2-hydroxy-3-methylbenzohydrazide |
| InChI | InChI=1/C8H10N2O2/c1-5-3-2-4-6(7(5)11)8(12)10-9/h2-4,11H,9H2,1H3,(H,10,12) |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.1772 |
| Density | 1.262g/cm3 |
| Refractive index | 1.607 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
30991-42-5 o-cresotic hydrazide
service@apichina.com