| Product Name | O-(2,3,4,5,6-Pentafluorobenzyl)hydroxylamine hydrochloride |
| CAS No. | 57981-02-9 |
| Synonyms | O-(2,3,4,5,6-pentafluorobenzyl)*hydroxylamine hyd; O-(pentafluorobenzyl)hydroxylamine; [(pentafluorobenzyl)oxy]ammonium chloride |
| InChI | InChI=1/C7H5F5NO.ClH/c8-3-2(1-14-13)4(9)6(11)7(12)5(3)10;/h1H2,13H3;1H/q+1;/p-1 |
| Molecular Formula | C7H5ClF5NO |
| Molecular Weight | 249.5657 |
| Melting point | 227℃ |
| Boiling point | 214.5°C at 760 mmHg |
| Flash point | 83.5°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
57981-02-9 o-(2,3,4,5,6-pentafluorobenzyl)hydroxylamine hydrochloride
service@apichina.com