| Product Name | Norephedrine hydrochloride |
| CAS No. | 3198-15-0 |
| Synonyms | Phenylpropanolamine hydrochloride; 2-Amino-1-phenyl-1-propanol hydrochloride; 2-amino-1-phenylpropan-1-ol |
| InChI | InChI=1/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.2056 |
| Density | 1.071g/cm3 |
| Melting point | 194-197℃ |
| Boiling point | 288.1°C at 760 mmHg |
| Flash point | 128.1°C |
| Refractive index | 1.557 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28A:After contact with skin, wash immediately with plenty of water.; |
3198-15-0 norephedrine hydrochloride
service@apichina.com