| Product Name | Nocodazole |
| CAS No. | 31430-18-9 |
| Synonyms | Methyl[5-(2-thienylcarbonyl)-1H-benzimidazol-2-yl]-carbamate; methyl (5-(2-thienylcarbonyl)-1H-benzimidazol-2-yl)carbamate; methyl [6-(thiophen-2-ylcarbonyl)-1H-benzimidazol-2-yl]carbamate |
| InChI | InChI=1/C14H11N3O3S/c1-20-14(19)17-13-15-9-5-4-8(7-10(9)16-13)12(18)11-3-2-6-21-11/h2-7H,1H3,(H2,15,16,17,19) |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.3204 |
| Density | 1.49g/cm3 |
| Melting point | 300-305℃ |
| Refractive index | 1.731 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; R40:Possible risks of irreversible effects.; R61:May cause harm to the unborn child.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S53:Avoid exposure - obtain special instructions before use.; |
31430-18-9 nocodazole
service@apichina.com