| Product Name | NN-Dipropylformamide |
| CAS No. | 6282-00-4 |
| Synonyms | N,N-Di-n-propylformamide; N,N-dipropylformamide |
| InChI | InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.2001 |
| Density | 0.869g/cm3 |
| Boiling point | 221.3°C at 760 mmHg |
| Flash point | 83.7°C |
| Refractive index | 1.429 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6282-00-4 nn-dipropylformamide
service@apichina.com